About 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine
2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine (PubChem CID 54060298) has the molecular formula C11H25N5+2
and a molecular weight of 227.36 g/mol. Its IUPAC name is 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine.
Molecular Properties
| Compound Name | 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine |
| PubChem CID | 54060298 |
| Molecular Formula | C11H25N5+2 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.21 |
| IUPAC Name | 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine |
| SMILES | C[C@@H](CN=C(N)N)[N+]12CC[N+](C)(CC1)CC2 |
| InChI | InChI=1S/C11H25N5/c1-10(9-14-11(12)13)16-6-3-15(2,4-7-16)5-8-16/h10H,3-9H2,1-2H3,(H4,12,13,14)/q+2/t10-,15?,16?/m0/s1 |
| InChIKey | LZFNOTMIODYTRM-CXPKIZLGSA-N |
| XLogP | -1.06 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine?
The IUPAC name of 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine (CID 54060298) is 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine.
What is the SMILES notation for 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine?
The canonical SMILES for 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine is C[C@@H](CN=C(N)N)[N+]12CC[N+](C)(CC1)CC2.
What is the InChIKey of 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine?
The InChIKey is LZFNOTMIODYTRM-CXPKIZLGSA-N. The full InChI is InChI=1S/C11H25N5/c1-10(9-14-11(12)13)16-6-3-15(2,4-7-16)5-8-16/h10H,3-9H2,1-2H3,(H4,12,13,14)/q+2/t10-,15?,16?/m0/s1.
What are the key properties of 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine?
2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine has a molecular weight of 227.36 g/mol, XLogP of -1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)propyl]guanidine is sourced from PubChem (CID 54060298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).