C7H17N3S — CID 144608807
2-(2-propan-2-ylsulfanylpropyl)guanidine (PubChem CID 144608807) has the molecular formula C7H17N3S and a molecular weight of 175.30 g/mol. Its IUPAC name is 2-(2-propan-2-ylsulfanylpropyl)guanidine.
| Compound Name | 2-(2-propan-2-ylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 144608807 |
| Molecular Formula | C7H17N3S |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(2-propan-2-ylsulfanylpropyl)guanidine |
| SMILES | CC(C)SC(C)CN=C(N)N |
| InChI | InChI=1S/C7H17N3S/c1-5(2)11-6(3)4-10-7(8)9/h5-6H,4H2,1-3H3,(H4,8,9,10) |
| InChIKey | CCGCQNLDXXIQGF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|