C38H34N4O6 — CID 54061666
1-[[4-[3-[4-[[carbamoyl(phenylmethoxy)amino]methyl]benzoyl]benzoyl]phenyl]methyl]-1-phenylmethoxyurea (PubChem CID 54061666) has the molecular formula C38H34N4O6 and a molecular weight of 642.71 g/mol. Its IUPAC name is 1-[[4-[3-[4-[[carbamoyl(phenylmethoxy)amino]methyl]benzoyl]benzoyl]phenyl]methyl]-1-phenylmethoxyurea.
| Compound Name | 1-[[4-[3-[4-[[carbamoyl(phenylmethoxy)amino]methyl]benzoyl]benzoyl]phenyl]methyl]-1-phenylmethoxyurea |
|---|---|
| PubChem CID | 54061666 |
| Molecular Formula | C38H34N4O6 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 1-[[4-[3-[4-[[carbamoyl(phenylmethoxy)amino]methyl]benzoyl]benzoyl]phenyl]methyl]-1-phenylmethoxyurea |
| SMILES | NC(=O)N(Cc1ccc(C(=O)c2cccc(C(=O)c3ccc(CN(OCc4ccccc4)C(N)=O)cc3)c2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H34N4O6/c39-37(45)41(47-25-29-8-3-1-4-9-29)23-27-14-18-31(19-15-27)35(43)33-12-7-13-34(22-33)36(44)32-20-16-28(17-21-32)24-42(38(40)46)48-26-30-10-5-2-6-11-30/h1-22H,23-26H2,(H2,39,45)(H2,40,46) |
| InChIKey | MADNTBLGEVOZJY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|