C21H23NO4 — CID 18666440
cis-(1R,3S)-3-[benzyl(phenylmethoxy)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 18666440) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is cis-(1R,3S)-3-[benzyl(phenylmethoxy)carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[benzyl(phenylmethoxy)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 18666440 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | cis-(1R,3S)-3-[benzyl(phenylmethoxy)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](C(=O)N(Cc2ccccc2)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO4/c23-20(18-11-12-19(13-18)21(24)25)22(14-16-7-3-1-4-8-16)26-15-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,24,25)/t18-,19+/m0/s1 |
| InChIKey | JJRNFBSQJMINMF-RBUKOAKNSA-N |
| XLogP | 3.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|