C28H29NO3 — CID 54061697
5-[4-[2-oxo-2-(2-phenylpropylamino)ethyl]phenyl]-4-phenylpent-4-enoic acid (PubChem CID 54061697) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is 5-[4-[2-oxo-2-(2-phenylpropylamino)ethyl]phenyl]-4-phenylpent-4-enoic acid.
| Compound Name | 5-[4-[2-oxo-2-(2-phenylpropylamino)ethyl]phenyl]-4-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 54061697 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 5-[4-[2-oxo-2-(2-phenylpropylamino)ethyl]phenyl]-4-phenylpent-4-enoic acid |
| SMILES | CC(CNC(=O)Cc1ccc(C=C(CCC(=O)O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO3/c1-21(24-8-4-2-5-9-24)20-29-27(30)19-23-14-12-22(13-15-23)18-26(16-17-28(31)32)25-10-6-3-7-11-25/h2-15,18,21H,16-17,19-20H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | MAEHIKZUJOQZMO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|