C19H25NO3 — CID 144787004
2-(3,4-dihydroxyphenyl)-N-(2-phenylpropyl)acetamide;ethane (PubChem CID 144787004) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-N-(2-phenylpropyl)acetamide;ethane.
| Compound Name | 2-(3,4-dihydroxyphenyl)-N-(2-phenylpropyl)acetamide;ethane |
|---|---|
| PubChem CID | 144787004 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-N-(2-phenylpropyl)acetamide;ethane |
| SMILES | CC.CC(CNC(=O)Cc1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3.C2H6/c1-12(14-5-3-2-4-6-14)11-18-17(21)10-13-7-8-15(19)16(20)9-13;1-2/h2-9,12,19-20H,10-11H2,1H3,(H,18,21);1-2H3 |
| InChIKey | FYCKFUJNQOTOQO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|