C16H16FNO2 — CID 103829491
4-fluoro-2-hydroxy-N-(2-phenylpropyl)benzamide (PubChem CID 103829491) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-(2-phenylpropyl)benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-(2-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 103829491 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-(2-phenylpropyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(F)cc1O)c1ccccc1 |
| InChI | InChI=1S/C16H16FNO2/c1-11(12-5-3-2-4-6-12)10-18-16(20)14-8-7-13(17)9-15(14)19/h2-9,11,19H,10H2,1H3,(H,18,20) |
| InChIKey | IZIGLXVJBKLBHT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |