C15H14FNO3 — CID 103829637
4-fluoro-2-hydroxy-N-(2-hydroxy-2-phenylethyl)benzamide (PubChem CID 103829637) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-(2-hydroxy-2-phenylethyl)benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-(2-hydroxy-2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 103829637 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-(2-hydroxy-2-phenylethyl)benzamide |
| SMILES | O=C(NCC(O)c1ccccc1)c1ccc(F)cc1O |
| InChI | InChI=1S/C15H14FNO3/c16-11-6-7-12(13(18)8-11)15(20)17-9-14(19)10-4-2-1-3-5-10/h1-8,14,18-19H,9H2,(H,17,20) |
| InChIKey | BLTWGFVSNMUNQA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |