C14H20FNO3 — CID 103830009
4-fluoro-2-hydroxy-N-(2-hydroxy-4,4-dimethylpentyl)benzamide (PubChem CID 103830009) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-(2-hydroxy-4,4-dimethylpentyl)benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-(2-hydroxy-4,4-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 103830009 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-(2-hydroxy-4,4-dimethylpentyl)benzamide |
| SMILES | CC(C)(C)CC(O)CNC(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C14H20FNO3/c1-14(2,3)7-10(17)8-16-13(19)11-5-4-9(15)6-12(11)18/h4-6,10,17-18H,7-8H2,1-3H3,(H,16,19) |
| InChIKey | CWWFYSNXBOXFDN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |