C12H16FNO4S — CID 103830101
4-fluoro-2-hydroxy-N-(2-methyl-2-methylsulfonylpropyl)benzamide (PubChem CID 103830101) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-(2-methyl-2-methylsulfonylpropyl)benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-(2-methyl-2-methylsulfonylpropyl)benzamide |
|---|---|
| PubChem CID | 103830101 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-(2-methyl-2-methylsulfonylpropyl)benzamide |
| SMILES | CC(C)(CNC(=O)c1ccc(F)cc1O)S(C)(=O)=O |
| InChI | InChI=1S/C12H16FNO4S/c1-12(2,19(3,17)18)7-14-11(16)9-5-4-8(13)6-10(9)15/h4-6,15H,7H2,1-3H3,(H,14,16) |
| InChIKey | CZVPFIKECJPDGP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |