C10H13FN2O4S — CID 102685154
4-fluoro-2-hydroxy-N-[2-(methylsulfamoyl)ethyl]benzamide (PubChem CID 102685154) has the molecular formula C10H13FN2O4S and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-[2-(methylsulfamoyl)ethyl]benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-[2-(methylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 102685154 |
| Molecular Formula | C10H13FN2O4S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-[2-(methylsulfamoyl)ethyl]benzamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C10H13FN2O4S/c1-12-18(16,17)5-4-13-10(15)8-3-2-7(11)6-9(8)14/h2-3,6,12,14H,4-5H2,1H3,(H,13,15) |
| InChIKey | UYCUSCMNLWYSOE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |