C12H17FN2O2 — CID 107015821
4-fluoro-2-hydroxy-N-[2-(propylamino)ethyl]benzamide (PubChem CID 107015821) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-[2-(propylamino)ethyl]benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-[2-(propylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 107015821 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-[2-(propylamino)ethyl]benzamide |
| SMILES | CCCNCCNC(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C12H17FN2O2/c1-2-5-14-6-7-15-12(17)10-4-3-9(13)8-11(10)16/h3-4,8,14,16H,2,5-7H2,1H3,(H,15,17) |
| InChIKey | NSASBESWNMVTNI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|