C9H22O6Si — CID 54062512
6-trimethylsilyloxyhexane-1,1,1,2,2-pentol (PubChem CID 54062512) has the molecular formula C9H22O6Si and a molecular weight of 254.35 g/mol. Its IUPAC name is 6-trimethylsilyloxyhexane-1,1,1,2,2-pentol.
| Compound Name | 6-trimethylsilyloxyhexane-1,1,1,2,2-pentol |
|---|---|
| PubChem CID | 54062512 |
| Molecular Formula | C9H22O6Si |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-trimethylsilyloxyhexane-1,1,1,2,2-pentol |
| SMILES | C[Si](C)(C)OCCCCC(O)(O)C(O)(O)O |
| InChI | InChI=1S/C9H22O6Si/c1-16(2,3)15-7-5-4-6-8(10,11)9(12,13)14/h10-14H,4-7H2,1-3H3 |
| InChIKey | MASODMMUZTUFPI-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|