C13H21Cl9OSi — CID 18927598
trimethyl(7,7,8,8,9,9,10,10,10-nonachlorodecoxy)silane (PubChem CID 18927598) has the molecular formula C13H21Cl9OSi and a molecular weight of 540.47 g/mol. Its IUPAC name is trimethyl(7,7,8,8,9,9,10,10,10-nonachlorodecoxy)silane.
| Compound Name | trimethyl(7,7,8,8,9,9,10,10,10-nonachlorodecoxy)silane |
|---|---|
| PubChem CID | 18927598 |
| Molecular Formula | C13H21Cl9OSi |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 535.86 |
| IUPAC Name | trimethyl(7,7,8,8,9,9,10,10,10-nonachlorodecoxy)silane |
| SMILES | C[Si](C)(C)OCCCCCCC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H21Cl9OSi/c1-24(2,3)23-9-7-5-4-6-8-10(14,15)11(16,17)12(18,19)13(20,21)22/h4-9H2,1-3H3 |
| InChIKey | SWYIJFRYVOAKAQ-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|