C11H16O2 — CID 54065526
cis-(1R,3R)-2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylic acid (PubChem CID 54065526) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is cis-(1R,3R)-2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 54065526 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | cis-(1R,3R)-2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylic acid |
| SMILES | C=CC(C)=C[C@@H]1[C@@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C11H16O2/c1-5-7(2)6-8-9(10(12)13)11(8,3)4/h5-6,8-9H,1H2,2-4H3,(H,12,13)/t8-,9+/m1/s1 |
| InChIKey | MCRAEYNBNUFCHX-BDAKNGLRSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|