C31H31F3N2O6 — CID 54065895
(2R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2,6-diethyl-3,4,5-trifluoroanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 54065895) has the molecular formula C31H31F3N2O6 and a molecular weight of 584.59 g/mol. Its IUPAC name is (2R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2,6-diethyl-3,4,5-trifluoroanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2,6-diethyl-3,4,5-trifluoroanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54065895 |
| Molecular Formula | C31H31F3N2O6 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | (2R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(2,6-diethyl-3,4,5-trifluoroanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCc1c(F)c(F)c(F)c(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)C(C(=O)O)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H31F3N2O6/c1-4-19-26(32)28(34)27(33)20(5-2)29(19)35-24(37)14-36-13-21(17-8-11-22-23(12-17)42-15-41-22)25(31(38)39)30(36)16-6-9-18(40-3)10-7-16/h6-12,21,25,30H,4-5,13-15H2,1-3H3,(H,35,37)(H,38,39)/t21-,25?,30+/m1/s1 |
| InChIKey | MCYHDIMQORUYPA-PKRRPUAMSA-N |
| XLogP | 5.45 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|