C34H40N2O6 — CID 54502404
(2R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-butoxyphenyl)-1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 54502404) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is (2R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-butoxyphenyl)-1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-butoxyphenyl)-1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54502404 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | (2R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-butoxyphenyl)-1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCCOc1ccc([C@H]2C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(CC)cccc2CC)cc1 |
| InChI | InChI=1S/C34H40N2O6/c1-4-7-17-40-26-14-11-24(12-15-26)33-31(34(38)39)27(25-13-16-28-29(18-25)42-21-41-28)19-36(33)20-30(37)35-32-22(5-2)9-8-10-23(32)6-3/h8-16,18,27,31,33H,4-7,17,19-21H2,1-3H3,(H,35,37)(H,38,39)/t27-,31?,33+/m1/s1 |
| InChIKey | YDIVQJXNNFEQOV-ILECXOQISA-N |
| XLogP | 6.20 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|