C36H43FN2O8 — CID 54198444
(2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 54198444) has the molecular formula C36H43FN2O8 and a molecular weight of 650.74 g/mol. Its IUPAC name is (2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54198444 |
| Molecular Formula | C36H43FN2O8 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | (2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCc1cc(F)cc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)C(C(=O)O)[C@@H]1c1ccc(OCCOCCOC)cc1 |
| InChI | InChI=1S/C36H43FN2O8/c1-4-23-18-27(37)19-24(5-2)34(23)38-32(40)22-39-21-29(26-8-11-30-31(20-26)47-17-16-46-30)33(36(41)42)35(39)25-6-9-28(10-7-25)45-15-14-44-13-12-43-3/h6-11,18-20,29,33,35H,4-5,12-17,21-22H2,1-3H3,(H,38,40)(H,41,42)/t29-,33?,35+/m1/s1 |
| InChIKey | PNMRRRHAYJCXTA-OZXJENOHSA-N |
| XLogP | 5.24 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|