C35H41ClN2O5 — CID 54003136
(2R,4S)-2-(4-butylphenyl)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-3-carboxylic acid (PubChem CID 54003136) has the molecular formula C35H41ClN2O5 and a molecular weight of 605.18 g/mol. Its IUPAC name is (2R,4S)-2-(4-butylphenyl)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,4S)-2-(4-butylphenyl)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54003136 |
| Molecular Formula | C35H41ClN2O5 |
| Molecular Weight | 605.18 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | (2R,4S)-2-(4-butylphenyl)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCc1ccc([C@H]2C(C(=O)O)[C@@H](c3ccc4c(c3)OCCO4)CN2CC(=O)Nc2c(CC)cc(Cl)cc2CC)cc1 |
| InChI | InChI=1S/C35H41ClN2O5/c1-4-7-8-22-9-11-25(12-10-22)34-32(35(40)41)28(26-13-14-29-30(19-26)43-16-15-42-29)20-38(34)21-31(39)37-33-23(5-2)17-27(36)18-24(33)6-3/h9-14,17-19,28,32,34H,4-8,15-16,20-21H2,1-3H3,(H,37,39)(H,40,41)/t28-,32?,34+/m1/s1 |
| InChIKey | KMZYBJAXZRPYQY-MFVYMYFASA-N |
| XLogP | 7.06 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.18 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |