C34H38ClFN2O8 — CID 54507293
(2R,4S)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-[4-(2-methoxyethoxymethoxy)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 54507293) has the molecular formula C34H38ClFN2O8 and a molecular weight of 657.13 g/mol. Its IUPAC name is (2R,4S)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-[4-(2-methoxyethoxymethoxy)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,4S)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-[4-(2-methoxyethoxymethoxy)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54507293 |
| Molecular Formula | C34H38ClFN2O8 |
| Molecular Weight | 657.13 g/mol |
| Exact Mass | 656.23 |
| IUPAC Name | (2R,4S)-1-[2-(4-chloro-2,6-diethylanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-[4-(2-methoxyethoxymethoxy)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCc1cc(Cl)cc(CC)c1NC(=O)CN1C[C@H](c2cc(F)c3c(c2)OCO3)C(C(=O)O)[C@@H]1c1ccc(OCOCCOC)cc1 |
| InChI | InChI=1S/C34H38ClFN2O8/c1-4-20-12-24(35)13-21(5-2)31(20)37-29(39)17-38-16-26(23-14-27(36)33-28(15-23)45-19-46-33)30(34(40)41)32(38)22-6-8-25(9-7-22)44-18-43-11-10-42-3/h6-9,12-15,26,30,32H,4-5,10-11,16-19H2,1-3H3,(H,37,39)(H,40,41)/t26-,30?,32+/m1/s1 |
| InChIKey | YGPOUPBTLBTYJZ-TULMOROLSA-N |
| XLogP | 5.81 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.13 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|