C34H37F2N3O5 — CID 54259383
(2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 54259383) has the molecular formula C34H37F2N3O5 and a molecular weight of 605.68 g/mol. Its IUPAC name is (2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54259383 |
| Molecular Formula | C34H37F2N3O5 |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | (2R,4S)-1-[2-(2,6-diethyl-4-fluoroanilino)-2-oxoethyl]-4-(7-fluoro-1,3-benzodioxol-5-yl)-2-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCc1cc(F)cc(CC)c1NC(=O)CN1C[C@H](c2cc(F)c3c(c2)OCO3)C(C(=O)O)[C@@H]1c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C34H37F2N3O5/c1-3-20-13-24(35)14-21(4-2)31(20)37-29(40)18-39-17-26(23-15-27(36)33-28(16-23)43-19-44-33)30(34(41)42)32(39)22-7-9-25(10-8-22)38-11-5-6-12-38/h7-10,13-16,26,30,32H,3-6,11-12,17-19H2,1-2H3,(H,37,40)(H,41,42)/t26-,30?,32+/m1/s1 |
| InChIKey | RCKCSNGWYBJAMI-TULMOROLSA-N |
| XLogP | 5.90 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|