C29H28FN3O — CID 54068803
(3R)-5-(2-fluorophenyl)-3-(1H-indol-3-yl)-6-methyl-1-pentyl-3H-1,4-benzodiazepin-2-one (PubChem CID 54068803) has the molecular formula C29H28FN3O and a molecular weight of 453.56 g/mol. Its IUPAC name is (3R)-5-(2-fluorophenyl)-3-(1H-indol-3-yl)-6-methyl-1-pentyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | (3R)-5-(2-fluorophenyl)-3-(1H-indol-3-yl)-6-methyl-1-pentyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 54068803 |
| Molecular Formula | C29H28FN3O |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (3R)-5-(2-fluorophenyl)-3-(1H-indol-3-yl)-6-methyl-1-pentyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CCCCCN1C(=O)[C@@H](c2c[nH]c3ccccc23)N=C(c2ccccc2F)c2c(C)cccc21 |
| InChI | InChI=1S/C29H28FN3O/c1-3-4-9-17-33-25-16-10-11-19(2)26(25)27(21-13-5-7-14-23(21)30)32-28(29(33)34)22-18-31-24-15-8-6-12-20(22)24/h5-8,10-16,18,28,31H,3-4,9,17H2,1-2H3/t28-/m1/s1 |
| InChIKey | MEYFXANHILOLGK-MUUNZHRXSA-N |
| XLogP | 6.73 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|