C18H26F2N2O — CID 82157533
6,7-difluoro-3-methyl-1-nonyl-3,4-dihydroquinoxalin-2-one (PubChem CID 82157533) has the molecular formula C18H26F2N2O and a molecular weight of 324.42 g/mol. Its IUPAC name is 6,7-difluoro-3-methyl-1-nonyl-3,4-dihydroquinoxalin-2-one.
| Compound Name | 6,7-difluoro-3-methyl-1-nonyl-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 82157533 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 6,7-difluoro-3-methyl-1-nonyl-3,4-dihydroquinoxalin-2-one |
| SMILES | CCCCCCCCCN1C(=O)C(C)Nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C18H26F2N2O/c1-3-4-5-6-7-8-9-10-22-17-12-15(20)14(19)11-16(17)21-13(2)18(22)23/h11-13,21H,3-10H2,1-2H3 |
| InChIKey | FEBFOBSREONEOH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|