C19H30N2O — CID 82157206
1-hexyl-6,7-dimethyl-3-propan-2-yl-3,4-dihydroquinoxalin-2-one (PubChem CID 82157206) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-hexyl-6,7-dimethyl-3-propan-2-yl-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-hexyl-6,7-dimethyl-3-propan-2-yl-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 82157206 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-hexyl-6,7-dimethyl-3-propan-2-yl-3,4-dihydroquinoxalin-2-one |
| SMILES | CCCCCCN1C(=O)C(C(C)C)Nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C19H30N2O/c1-6-7-8-9-10-21-17-12-15(5)14(4)11-16(17)20-18(13(2)3)19(21)22/h11-13,18,20H,6-10H2,1-5H3 |
| InChIKey | LREWSUYZCCNUGP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|