C13H18N2O — CID 82157287
1-ethyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one (PubChem CID 82157287) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-ethyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-ethyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 82157287 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-ethyl-3,6,7-trimethyl-3,4-dihydroquinoxalin-2-one |
| SMILES | CCN1C(=O)C(C)Nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C13H18N2O/c1-5-15-12-7-9(3)8(2)6-11(12)14-10(4)13(15)16/h6-7,10,14H,5H2,1-4H3 |
| InChIKey | VKWSSGZZOARERG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |