C32H34F2N2O5 — CID 54068915
benzyl N-[(2S)-1-[(4,4-difluoro-3,5-dioxo-1,7-diphenylheptan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 54068915) has the molecular formula C32H34F2N2O5 and a molecular weight of 564.63 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(4,4-difluoro-3,5-dioxo-1,7-diphenylheptan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(4,4-difluoro-3,5-dioxo-1,7-diphenylheptan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 54068915 |
| Molecular Formula | C32H34F2N2O5 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | benzyl N-[(2S)-1-[(4,4-difluoro-3,5-dioxo-1,7-diphenylheptan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)C(F)(F)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C32H34F2N2O5/c1-22(2)28(36-31(40)41-21-25-16-10-5-11-17-25)30(39)35-26(20-24-14-8-4-9-15-24)29(38)32(33,34)27(37)19-18-23-12-6-3-7-13-23/h3-17,22,26,28H,18-21H2,1-2H3,(H,35,39)(H,36,40)/t26?,28-/m0/s1 |
| InChIKey | MEZUDDJEDAEEOE-RXBHZZDJSA-N |
| XLogP | 5.07 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|