C22H34O10 — CID 54071379
bis(2,2-dimethyl-3-prop-2-enoylperoxypropyl) hexanedioate (PubChem CID 54071379) has the molecular formula C22H34O10 and a molecular weight of 458.50 g/mol. Its IUPAC name is bis(2,2-dimethyl-3-prop-2-enoylperoxypropyl) hexanedioate.
| Compound Name | bis(2,2-dimethyl-3-prop-2-enoylperoxypropyl) hexanedioate |
|---|---|
| PubChem CID | 54071379 |
| Molecular Formula | C22H34O10 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | bis(2,2-dimethyl-3-prop-2-enoylperoxypropyl) hexanedioate |
| SMILES | C=CC(=O)OOCC(C)(C)COC(=O)CCCCC(=O)OCC(C)(C)COOC(=O)C=C |
| InChI | InChI=1S/C22H34O10/c1-7-17(23)31-29-15-21(3,4)13-27-19(25)11-9-10-12-20(26)28-14-22(5,6)16-30-32-18(24)8-2/h7-8H,1-2,9-16H2,3-6H3 |
| InChIKey | MGRVWJBCRJHCPS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|