C21H39NO — CID 54076447
1-(2,6-dimethylazepan-4-yl)tridec-11-en-1-one (PubChem CID 54076447) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is 1-(2,6-dimethylazepan-4-yl)tridec-11-en-1-one.
| Compound Name | 1-(2,6-dimethylazepan-4-yl)tridec-11-en-1-one |
|---|---|
| PubChem CID | 54076447 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | 1-(2,6-dimethylazepan-4-yl)tridec-11-en-1-one |
| SMILES | CC=CCCCCCCCCCC(=O)C1CC(C)CNC(C)C1 |
| InChI | InChI=1S/C21H39NO/c1-4-5-6-7-8-9-10-11-12-13-14-21(23)20-15-18(2)17-22-19(3)16-20/h4-5,18-20,22H,6-17H2,1-3H3 |
| InChIKey | MKAXBMMUTCBUCV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|