C27H37N3 — CID 54078246
4-[5-(4-decylphenyl)pyrimidin-2-yl]cyclohexane-1-carbonitrile (PubChem CID 54078246) has the molecular formula C27H37N3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 4-[5-(4-decylphenyl)pyrimidin-2-yl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[5-(4-decylphenyl)pyrimidin-2-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 54078246 |
| Molecular Formula | C27H37N3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.30 |
| IUPAC Name | 4-[5-(4-decylphenyl)pyrimidin-2-yl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCCCCCCc1ccc(-c2cnc(C3CCC(C#N)CC3)nc2)cc1 |
| InChI | InChI=1S/C27H37N3/c1-2-3-4-5-6-7-8-9-10-22-11-15-24(16-12-22)26-20-29-27(30-21-26)25-17-13-23(19-28)14-18-25/h11-12,15-16,20-21,23,25H,2-10,13-14,17-18H2,1H3 |
| InChIKey | MLFXWVXFFCXYCC-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|