C25H30N4O — CID 70427179
4-[[4-(5-hexylpyrimidin-2-yl)cyclohexyl]methoxy]benzene-1,2-dicarbonitrile (PubChem CID 70427179) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 4-[[4-(5-hexylpyrimidin-2-yl)cyclohexyl]methoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[[4-(5-hexylpyrimidin-2-yl)cyclohexyl]methoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 70427179 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 4-[[4-(5-hexylpyrimidin-2-yl)cyclohexyl]methoxy]benzene-1,2-dicarbonitrile |
| SMILES | CCCCCCc1cnc(C2CCC(COc3ccc(C#N)c(C#N)c3)CC2)nc1 |
| InChI | InChI=1S/C25H30N4O/c1-2-3-4-5-6-20-16-28-25(29-17-20)21-9-7-19(8-10-21)18-30-24-12-11-22(14-26)23(13-24)15-27/h11-13,16-17,19,21H,2-10,18H2,1H3 |
| InChIKey | OMSIWNQJKFHAGO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 82.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|