C21H23FN2O — CID 70350329
4-[[4-(5-ethyl-2-pyridinyl)cyclohexyl]methoxy]-2-fluorobenzonitrile (PubChem CID 70350329) has the molecular formula C21H23FN2O and a molecular weight of 338.43 g/mol. Its IUPAC name is 4-[[4-(5-ethyl-2-pyridinyl)cyclohexyl]methoxy]-2-fluorobenzonitrile.
| Compound Name | 4-[[4-(5-ethyl-2-pyridinyl)cyclohexyl]methoxy]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 70350329 |
| Molecular Formula | C21H23FN2O |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 4-[[4-(5-ethyl-2-pyridinyl)cyclohexyl]methoxy]-2-fluorobenzonitrile |
| SMILES | CCc1ccc(C2CCC(COc3ccc(C#N)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C21H23FN2O/c1-2-15-5-10-21(24-13-15)17-6-3-16(4-7-17)14-25-19-9-8-18(12-23)20(22)11-19/h5,8-11,13,16-17H,2-4,6-7,14H2,1H3 |
| InChIKey | LYWNPHBMFDQYHO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |