About 3-methylpentanethioamide
3-methylpentanethioamide (PubChem CID 54078997) has the molecular formula C6H13NS
and a molecular weight of 131.24 g/mol. Its IUPAC name is 3-methylpentanethioamide.
Molecular Properties
| Compound Name | 3-methylpentanethioamide |
| PubChem CID | 54078997 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 3-methylpentanethioamide |
| SMILES | CCC(C)CC(N)=S |
| InChI | InChI=1S/C6H13NS/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | MLSRNWLQISGUGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentanethioamide?
The IUPAC name of 3-methylpentanethioamide (CID 54078997) is 3-methylpentanethioamide.
What is the SMILES notation for 3-methylpentanethioamide?
The canonical SMILES for 3-methylpentanethioamide is CCC(C)CC(N)=S.
What is the InChIKey of 3-methylpentanethioamide?
The InChIKey is MLSRNWLQISGUGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NS/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H2,7,8).
What are the key properties of 3-methylpentanethioamide?
3-methylpentanethioamide has a molecular weight of 131.24 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentanethioamide is sourced from PubChem (CID 54078997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).