About 3-ethylpentanethioamide
3-ethylpentanethioamide (PubChem CID 82925647) has the molecular formula C7H15NS
and a molecular weight of 145.27 g/mol. Its IUPAC name is 3-ethylpentanethioamide.
Molecular Properties
| Compound Name | 3-ethylpentanethioamide |
| PubChem CID | 82925647 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-ethylpentanethioamide |
| SMILES | CCC(CC)CC(N)=S |
| InChI | InChI=1S/C7H15NS/c1-3-6(4-2)5-7(8)9/h6H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | BSACQEGAPNPJIX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpentanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpentanethioamide?
The IUPAC name of 3-ethylpentanethioamide (CID 82925647) is 3-ethylpentanethioamide.
What is the SMILES notation for 3-ethylpentanethioamide?
The canonical SMILES for 3-ethylpentanethioamide is CCC(CC)CC(N)=S.
What is the InChIKey of 3-ethylpentanethioamide?
The InChIKey is BSACQEGAPNPJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS/c1-3-6(4-2)5-7(8)9/h6H,3-5H2,1-2H3,(H2,8,9).
What are the key properties of 3-ethylpentanethioamide?
3-ethylpentanethioamide has a molecular weight of 145.27 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentanethioamide is sourced from PubChem (CID 82925647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).