C7H8O5 — CID 54079768
(3aR,6aS)-2,2-dimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,6-dione (PubChem CID 54079768) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is (3aR,6aS)-2,2-dimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,6-dione.
| Compound Name | (3aR,6aS)-2,2-dimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,6-dione |
|---|---|
| PubChem CID | 54079768 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (3aR,6aS)-2,2-dimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxole-4,6-dione |
| SMILES | CC1(C)O[C@@H]2C(=O)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C7H8O5/c1-7(2)11-3-4(12-7)6(9)10-5(3)8/h3-4H,1-2H3/t3-,4+ |
| InChIKey | MMGPOKTWTFRTJW-ZXZARUISSA-N |
| XLogP | -0.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|