C27H23F4N5O2 — CID 54080643
benzyl 4-[5-(2-fluoro-4-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperazine-1-carboxylate (PubChem CID 54080643) has the molecular formula C27H23F4N5O2 and a molecular weight of 525.51 g/mol. Its IUPAC name is benzyl 4-[5-(2-fluoro-4-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[5-(2-fluoro-4-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54080643 |
| Molecular Formula | C27H23F4N5O2 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | benzyl 4-[5-(2-fluoro-4-pyridinyl)-4-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2nc(-c3cccc(C(F)(F)F)c3)c(-c3ccnc(F)c3)[nH]2)CC1 |
| InChI | InChI=1S/C27H23F4N5O2/c28-22-16-20(9-10-32-22)24-23(19-7-4-8-21(15-19)27(29,30)31)33-25(34-24)35-11-13-36(14-12-35)26(37)38-17-18-5-2-1-3-6-18/h1-10,15-16H,11-14,17H2,(H,33,34) |
| InChIKey | MMVZMXVIXAYMBO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|