C25H32O5 — CID 54080931
methyl 5-butyl-9-hexyl-3-methyl-4-oxo-5H-pyrano[3,2-c]chromene-2-carboxylate (PubChem CID 54080931) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is methyl 5-butyl-9-hexyl-3-methyl-4-oxo-5H-pyrano[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl 5-butyl-9-hexyl-3-methyl-4-oxo-5H-pyrano[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 54080931 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | methyl 5-butyl-9-hexyl-3-methyl-4-oxo-5H-pyrano[3,2-c]chromene-2-carboxylate |
| SMILES | CCCCCCc1ccc2c(c1)-c1oc(C(=O)OC)c(C)c(=O)c1C(CCCC)O2 |
| InChI | InChI=1S/C25H32O5/c1-5-7-9-10-11-17-13-14-19-18(15-17)24-21(20(29-19)12-8-6-2)22(26)16(3)23(30-24)25(27)28-4/h13-15,20H,5-12H2,1-4H3 |
| InChIKey | MNBJXCKENLHSSD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|