About CID 173442079
CID 173442079 (PubChem CID 173442079) has the molecular formula C21H32BF2O3
and a molecular weight of 381.29 g/mol.
Molecular Properties
| Compound Name | CID 173442079 |
| PubChem CID | 173442079 |
| Molecular Formula | C21H32BF2O3 |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | — |
| SMILES | CCCCCCc1ccc2c(c1)C(=O)C(C(C)=O)C(CCCC)O2.F.F.[B] |
| InChI | InChI=1S/C21H30O3.B.2FH/c1-4-6-8-9-10-16-12-13-18-17(14-16)21(23)20(15(3)22)19(24-18)11-7-5-2;;;/h12-14,19-20H,4-11H2,1-3H3;;2*1H |
| InChIKey | UNPHELWCFFNZEO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173442079 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173442079?
The IUPAC name of CID 173442079 (CID 173442079) is not available.
What is the SMILES notation for CID 173442079?
The canonical SMILES for CID 173442079 is CCCCCCc1ccc2c(c1)C(=O)C(C(C)=O)C(CCCC)O2.F.F.[B].
What is the InChIKey of CID 173442079?
The InChIKey is UNPHELWCFFNZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O3.B.2FH/c1-4-6-8-9-10-16-12-13-18-17(14-16)21(23)20(15(3)22)19(24-18)11-7-5-2;;;/h12-14,19-20H,4-11H2,1-3H3;;2*1H.
What are the key properties of CID 173442079?
CID 173442079 has a molecular weight of 381.29 g/mol, XLogP of 5.07, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173442079 is sourced from PubChem (CID 173442079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).