C23H21FN2O6S — CID 54081106
2-[4-[[2-[(4-fluorophenyl)sulfonylamino]-3-phenoxypropanoyl]amino]phenyl]acetic acid (PubChem CID 54081106) has the molecular formula C23H21FN2O6S and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-[4-[[2-[(4-fluorophenyl)sulfonylamino]-3-phenoxypropanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-[(4-fluorophenyl)sulfonylamino]-3-phenoxypropanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 54081106 |
| Molecular Formula | C23H21FN2O6S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[4-[[2-[(4-fluorophenyl)sulfonylamino]-3-phenoxypropanoyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)C(COc2ccccc2)NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H21FN2O6S/c24-17-8-12-20(13-9-17)33(30,31)26-21(15-32-19-4-2-1-3-5-19)23(29)25-18-10-6-16(7-11-18)14-22(27)28/h1-13,21,26H,14-15H2,(H,25,29)(H,27,28) |
| InChIKey | MNEFGQMSIQUZCY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |