N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride

C5H9F2NO — CID 54081738

IUPACN-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride
SMILESCC(C)N(CF)C(=O)F
InChIInChI=1S/C5H9F2NO/c1-4(2)8(3-6)5(7)9/h4H,3H2,1-2H3
InChIKeyMNPIJTMYTJBMIT-UHFFFAOYSA-N
MW137.13 g/mol
LogP1.71
Rot. Bonds2

About N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride

N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride (PubChem CID 54081738) has the molecular formula C5H9F2NO and a molecular weight of 137.13 g/mol. Its IUPAC name is N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride.

Molecular Properties

Compound NameN-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride
PubChem CID54081738
Molecular FormulaC5H9F2NO
Molecular Weight137.13 g/mol
Exact Mass137.07
IUPAC NameN-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride
SMILESCC(C)N(CF)C(=O)F
InChIInChI=1S/C5H9F2NO/c1-4(2)8(3-6)5(7)9/h4H,3H2,1-2H3
InChIKeyMNPIJTMYTJBMIT-UHFFFAOYSA-N
XLogP1.71
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.13
LogP ≤ 51.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride?
The IUPAC name of N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride (CID 54081738) is N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride.
What is the SMILES notation for N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride?
The canonical SMILES for N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride is CC(C)N(CF)C(=O)F.
What is the InChIKey of N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride?
The InChIKey is MNPIJTMYTJBMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2NO/c1-4(2)8(3-6)5(7)9/h4H,3H2,1-2H3.
What are the key properties of N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride?
N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride has a molecular weight of 137.13 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(fluoromethyl)-N-propan-2-ylcarbamoyl fluoride is sourced from PubChem (CID 54081738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).