About 2-(diethylamino)propanoyl fluoride;hydrofluoride
2-(diethylamino)propanoyl fluoride;hydrofluoride (PubChem CID 88650459) has the molecular formula C7H15F2NO
and a molecular weight of 167.20 g/mol. Its IUPAC name is 2-(diethylamino)propanoyl fluoride;hydrofluoride.
Molecular Properties
| Compound Name | 2-(diethylamino)propanoyl fluoride;hydrofluoride |
| PubChem CID | 88650459 |
| Molecular Formula | C7H15F2NO |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(diethylamino)propanoyl fluoride;hydrofluoride |
| SMILES | CCN(CC)C(C)C(=O)F.F |
| InChI | InChI=1S/C7H14FNO.FH/c1-4-9(5-2)6(3)7(8)10;/h6H,4-5H2,1-3H3;1H |
| InChIKey | PHSNUAOAYGYZGG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)propanoyl fluoride;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)propanoyl fluoride;hydrofluoride?
The IUPAC name of 2-(diethylamino)propanoyl fluoride;hydrofluoride (CID 88650459) is 2-(diethylamino)propanoyl fluoride;hydrofluoride.
What is the SMILES notation for 2-(diethylamino)propanoyl fluoride;hydrofluoride?
The canonical SMILES for 2-(diethylamino)propanoyl fluoride;hydrofluoride is CCN(CC)C(C)C(=O)F.F.
What is the InChIKey of 2-(diethylamino)propanoyl fluoride;hydrofluoride?
The InChIKey is PHSNUAOAYGYZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FNO.FH/c1-4-9(5-2)6(3)7(8)10;/h6H,4-5H2,1-3H3;1H.
What are the key properties of 2-(diethylamino)propanoyl fluoride;hydrofluoride?
2-(diethylamino)propanoyl fluoride;hydrofluoride has a molecular weight of 167.20 g/mol, XLogP of 1.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)propanoyl fluoride;hydrofluoride is sourced from PubChem (CID 88650459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).