C11H16O4 — CID 54082938
1-O-ethyl 3-O-methyl cyclohex-3-ene-1,3-dicarboxylate (PubChem CID 54082938) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl cyclohex-3-ene-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-methyl cyclohex-3-ene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 54082938 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-O-ethyl 3-O-methyl cyclohex-3-ene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CCC=C(C(=O)OC)C1 |
| InChI | InChI=1S/C11H16O4/c1-3-15-11(13)9-6-4-5-8(7-9)10(12)14-2/h5,9H,3-4,6-7H2,1-2H3 |
| InChIKey | MOJZHZKPVPTBBX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |