C7H9NO3S2 — CID 54082984
ethyl 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)acetate (PubChem CID 54082984) has the molecular formula C7H9NO3S2 and a molecular weight of 219.29 g/mol. Its IUPAC name is ethyl 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)acetate.
| Compound Name | ethyl 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)acetate |
|---|---|
| PubChem CID | 54082984 |
| Molecular Formula | C7H9NO3S2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | ethyl 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)acetate |
| SMILES | CCOC(=O)Cn1c(O)csc1=S |
| InChI | InChI=1S/C7H9NO3S2/c1-2-11-6(10)3-8-5(9)4-13-7(8)12/h4,9H,2-3H2,1H3 |
| InChIKey | MOKVPVQINUHIRZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|