About 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate
2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate (PubChem CID 57234222) has the molecular formula C7H9NO3S2
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate |
| PubChem CID | 57234222 |
| Molecular Formula | C7H9NO3S2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate |
| SMILES | CC(=O)OCCn1c(O)csc1=S |
| InChI | InChI=1S/C7H9NO3S2/c1-5(9)11-3-2-8-6(10)4-13-7(8)12/h4,10H,2-3H2,1H3 |
| InChIKey | OIUPBACPNVSFSS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate?
The IUPAC name of 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate (CID 57234222) is 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate.
What is the SMILES notation for 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate?
The canonical SMILES for 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate is CC(=O)OCCn1c(O)csc1=S.
What is the InChIKey of 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate?
The InChIKey is OIUPBACPNVSFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S2/c1-5(9)11-3-2-8-6(10)4-13-7(8)12/h4,10H,2-3H2,1H3.
What are the key properties of 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate?
2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate has a molecular weight of 219.29 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl acetate is sourced from PubChem (CID 57234222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).