C8H14BrNO4 — CID 54083771
(2S)-2-(2-bromoethoxycarbonylamino)-3-methylbutanoic acid (PubChem CID 54083771) has the molecular formula C8H14BrNO4 and a molecular weight of 268.11 g/mol. Its IUPAC name is (2S)-2-(2-bromoethoxycarbonylamino)-3-methylbutanoic acid.
| Compound Name | (2S)-2-(2-bromoethoxycarbonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54083771 |
| Molecular Formula | C8H14BrNO4 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (2S)-2-(2-bromoethoxycarbonylamino)-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCCBr)C(=O)O |
| InChI | InChI=1S/C8H14BrNO4/c1-5(2)6(7(11)12)10-8(13)14-4-3-9/h5-6H,3-4H2,1-2H3,(H,10,13)(H,11,12)/t6-/m0/s1 |
| InChIKey | MOYSERPELVBQBC-LURJTMIESA-N |
| XLogP | 1.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|