C8H12Cl3NO4 — CID 119092788
(2S)-3-methyl-2-(1,1,2-trichloroethoxycarbonylamino)butanoic acid (PubChem CID 119092788) has the molecular formula C8H12Cl3NO4 and a molecular weight of 292.55 g/mol. Its IUPAC name is (2S)-3-methyl-2-(1,1,2-trichloroethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-3-methyl-2-(1,1,2-trichloroethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 119092788 |
| Molecular Formula | C8H12Cl3NO4 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | (2S)-3-methyl-2-(1,1,2-trichloroethoxycarbonylamino)butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OC(Cl)(Cl)CCl)C(=O)O |
| InChI | InChI=1S/C8H12Cl3NO4/c1-4(2)5(6(13)14)12-7(15)16-8(10,11)3-9/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14)/t5-/m0/s1 |
| InChIKey | AILVFNBGUNGYBF-YFKPBYRVSA-N |
| XLogP | 2.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|