C12H14N2O5 — CID 54087634
1-[4-(2,5-dihydroxypyrrol-1-yl)oxybutan-2-yl]pyrrole-2,5-dione (PubChem CID 54087634) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 1-[4-(2,5-dihydroxypyrrol-1-yl)oxybutan-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(2,5-dihydroxypyrrol-1-yl)oxybutan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 54087634 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[4-(2,5-dihydroxypyrrol-1-yl)oxybutan-2-yl]pyrrole-2,5-dione |
| SMILES | CC(CCOn1c(O)ccc1O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H14N2O5/c1-8(13-9(15)2-3-10(13)16)6-7-19-14-11(17)4-5-12(14)18/h2-5,8,17-18H,6-7H2,1H3 |
| InChIKey | MRPCPWQDDDQIEJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|