C12H15IN2O7 — CID 54253044
3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]-(2-iodoacetyl)amino]propanoic acid (PubChem CID 54253044) has the molecular formula C12H15IN2O7 and a molecular weight of 426.16 g/mol. Its IUPAC name is 3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]-(2-iodoacetyl)amino]propanoic acid.
| Compound Name | 3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]-(2-iodoacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 54253044 |
| Molecular Formula | C12H15IN2O7 |
| Molecular Weight | 426.16 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 3-[[3-(2,5-dihydroxypyrrol-1-yl)oxy-3-oxopropyl]-(2-iodoacetyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC(=O)On1c(O)ccc1O)C(=O)CI |
| InChI | InChI=1S/C12H15IN2O7/c13-7-10(18)14(5-3-11(19)20)6-4-12(21)22-15-8(16)1-2-9(15)17/h1-2,16-17H,3-7H2,(H,19,20) |
| InChIKey | QYCLEERRHVRNKN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|