C15H12ClN5O5S2 — CID 54088146
(6S)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54088146) has the molecular formula C15H12ClN5O5S2 and a molecular weight of 441.88 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54088146 |
| Molecular Formula | C15H12ClN5O5S2 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | (6S)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-prop-2-ynoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C#CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=CCS[C@@H]12)c1nc(N)sc1Cl |
| InChI | InChI=1S/C15H12ClN5O5S2/c1-2-4-26-20-8(7-10(16)28-15(17)19-7)11(22)18-9-12(23)21-6(14(24)25)3-5-27-13(9)21/h1,3,9,13H,4-5H2,(H2,17,19)(H,18,22)(H,24,25)/t9?,13-/m0/s1 |
| InChIKey | MRYCSPWWUQBVDN-NCWAPJAISA-N |
| XLogP | 0.10 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|