C20H30N2S — CID 54088591
5-(4-butylphenyl)-2-(4-ethylcyclohexyl)-5H-thiadiazole (PubChem CID 54088591) has the molecular formula C20H30N2S and a molecular weight of 330.54 g/mol. Its IUPAC name is 5-(4-butylphenyl)-2-(4-ethylcyclohexyl)-5H-thiadiazole.
| Compound Name | 5-(4-butylphenyl)-2-(4-ethylcyclohexyl)-5H-thiadiazole |
|---|---|
| PubChem CID | 54088591 |
| Molecular Formula | C20H30N2S |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 5-(4-butylphenyl)-2-(4-ethylcyclohexyl)-5H-thiadiazole |
| SMILES | CCCCc1ccc(C2C=NN(C3CCC(CC)CC3)S2)cc1 |
| InChI | InChI=1S/C20H30N2S/c1-3-5-6-17-7-11-18(12-8-17)20-15-21-22(23-20)19-13-9-16(4-2)10-14-19/h7-8,11-12,15-16,19-20H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | MSGGJPUQUPHZPP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|