C13H14N2O2 — CID 5408993
(3Z,6S)-6-methyl-3-phenacylidenepiperazin-2-one (PubChem CID 5408993) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (3Z,6S)-6-methyl-3-phenacylidenepiperazin-2-one.
| Compound Name | (3Z,6S)-6-methyl-3-phenacylidenepiperazin-2-one |
|---|---|
| PubChem CID | 5408993 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (3Z,6S)-6-methyl-3-phenacylidenepiperazin-2-one |
| SMILES | C[C@H]1CN/C(=C\C(=O)c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C13H14N2O2/c1-9-8-14-11(13(17)15-9)7-12(16)10-5-3-2-4-6-10/h2-7,9,14H,8H2,1H3,(H,15,17)/b11-7-/t9-/m0/s1 |
| InChIKey | GKUSCRCVAUAOEB-MKVDPYIPSA-N |
| XLogP | 0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|